C14H14ClF3N4O2 — CID 36579604
4-(4-chloro-2-methylphenoxy)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]butanamide (PubChem CID 36579604) has the molecular formula C14H14ClF3N4O2 and a molecular weight of 362.74 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]butanamide |
|---|---|
| PubChem CID | 36579604 |
| Molecular Formula | C14H14ClF3N4O2 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)Nc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H14ClF3N4O2/c1-8-7-9(15)4-5-10(8)24-6-2-3-11(23)19-13-20-12(21-22-13)14(16,17)18/h4-5,7H,2-3,6H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | ZDAIQMXPEZAESM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|