C34H34Cl2N2O5 — CID 5198436
4-(4-chloro-2-methylphenoxy)-N-[4-[4-[4-(4-chloro-2-methylphenoxy)butanoylamino]phenoxy]phenyl]butanamide (PubChem CID 5198436) has the molecular formula C34H34Cl2N2O5 and a molecular weight of 621.56 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-[4-[4-[4-(4-chloro-2-methylphenoxy)butanoylamino]phenoxy]phenyl]butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-[4-[4-[4-(4-chloro-2-methylphenoxy)butanoylamino]phenoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 5198436 |
| Molecular Formula | C34H34Cl2N2O5 |
| Molecular Weight | 621.56 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-[4-[4-[4-(4-chloro-2-methylphenoxy)butanoylamino]phenoxy]phenyl]butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)Nc1ccc(Oc2ccc(NC(=O)CCCOc3ccc(Cl)cc3C)cc2)cc1 |
| InChI | InChI=1S/C34H34Cl2N2O5/c1-23-21-25(35)7-17-31(23)41-19-3-5-33(39)37-27-9-13-29(14-10-27)43-30-15-11-28(12-16-30)38-34(40)6-4-20-42-32-18-8-26(36)22-24(32)2/h7-18,21-22H,3-6,19-20H2,1-2H3,(H,37,39)(H,38,40) |
| InChIKey | MXGDQPIZAYBWNC-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.56 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|