C23H22ClN3O2 — CID 4640199
4-(4-chloro-2-methylphenoxy)-N-(4-phenyldiazenylphenyl)butanamide (PubChem CID 4640199) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-(4-phenyldiazenylphenyl)butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-(4-phenyldiazenylphenyl)butanamide |
|---|---|
| PubChem CID | 4640199 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-(4-phenyldiazenylphenyl)butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22ClN3O2/c1-17-16-18(24)9-14-22(17)29-15-5-8-23(28)25-19-10-12-21(13-11-19)27-26-20-6-3-2-4-7-20/h2-4,6-7,9-14,16H,5,8,15H2,1H3,(H,25,28)/b27-26+ |
| InChIKey | USALMNSEFWYJNF-CYYJNZCTSA-N |
| XLogP | 6.86 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|