C23H20Cl2N2O3 — CID 17235361
N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]benzamide (PubChem CID 17235361) has the molecular formula C23H20Cl2N2O3 and a molecular weight of 443.33 g/mol. Its IUPAC name is N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]benzamide.
| Compound Name | N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 17235361 |
| Molecular Formula | C23H20Cl2N2O3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]benzamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O3/c24-17-8-13-21(20(25)15-17)30-14-4-7-22(28)26-18-9-11-19(12-10-18)27-23(29)16-5-2-1-3-6-16/h1-3,5-6,8-13,15H,4,7,14H2,(H,26,28)(H,27,29) |
| InChIKey | BHTOCVDKWZZGQO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|