C15H13Cl3N2O2 — CID 54787916
N-(6-chloro-3-pyridinyl)-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 54787916) has the molecular formula C15H13Cl3N2O2 and a molecular weight of 359.64 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 54787916 |
| Molecular Formula | C15H13Cl3N2O2 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H13Cl3N2O2/c16-10-3-5-13(12(17)8-10)22-7-1-2-15(21)20-11-4-6-14(18)19-9-11/h3-6,8-9H,1-2,7H2,(H,20,21) |
| InChIKey | NZGOIYYDKMDDOM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|