C26H23Cl4N3O6 — CID 5181794
4-(2,4-dichlorophenoxy)-N-[3-[4-(2,4-dichlorophenoxy)butanoylamino]-4-nitrophenyl]butanamide (PubChem CID 5181794) has the molecular formula C26H23Cl4N3O6 and a molecular weight of 615.30 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[3-[4-(2,4-dichlorophenoxy)butanoylamino]-4-nitrophenyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[3-[4-(2,4-dichlorophenoxy)butanoylamino]-4-nitrophenyl]butanamide |
|---|---|
| PubChem CID | 5181794 |
| Molecular Formula | C26H23Cl4N3O6 |
| Molecular Weight | 615.30 g/mol |
| Exact Mass | 613.03 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[3-[4-(2,4-dichlorophenoxy)butanoylamino]-4-nitrophenyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nc1ccc([N+](=O)[O-])c(NC(=O)CCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C26H23Cl4N3O6/c27-16-5-9-23(19(29)13-16)38-11-1-3-25(34)31-18-7-8-22(33(36)37)21(15-18)32-26(35)4-2-12-39-24-10-6-17(28)14-20(24)30/h5-10,13-15H,1-4,11-12H2,(H,31,34)(H,32,35) |
| InChIKey | GTZJDRARAOMGOW-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.30 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|