C17H14Cl3N3O5 — CID 3382871
4-chloro-N'-[4-(2,4-dichlorophenoxy)butanoyl]-3-nitrobenzohydrazide (PubChem CID 3382871) has the molecular formula C17H14Cl3N3O5 and a molecular weight of 446.67 g/mol. Its IUPAC name is 4-chloro-N'-[4-(2,4-dichlorophenoxy)butanoyl]-3-nitrobenzohydrazide.
| Compound Name | 4-chloro-N'-[4-(2,4-dichlorophenoxy)butanoyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 3382871 |
| Molecular Formula | C17H14Cl3N3O5 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 4-chloro-N'-[4-(2,4-dichlorophenoxy)butanoyl]-3-nitrobenzohydrazide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14Cl3N3O5/c18-11-4-6-15(13(20)9-11)28-7-1-2-16(24)21-22-17(25)10-3-5-12(19)14(8-10)23(26)27/h3-6,8-9H,1-2,7H2,(H,21,24)(H,22,25) |
| InChIKey | XQBXPFQZEDOTQE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|