C23H26Cl2N2O6 — CID 55741701
4-(4-acetyl-2-methoxyphenoxy)-N'-[4-(2,4-dichlorophenoxy)butanoyl]butanehydrazide (PubChem CID 55741701) has the molecular formula C23H26Cl2N2O6 and a molecular weight of 497.38 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N'-[4-(2,4-dichlorophenoxy)butanoyl]butanehydrazide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N'-[4-(2,4-dichlorophenoxy)butanoyl]butanehydrazide |
|---|---|
| PubChem CID | 55741701 |
| Molecular Formula | C23H26Cl2N2O6 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N'-[4-(2,4-dichlorophenoxy)butanoyl]butanehydrazide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H26Cl2N2O6/c1-15(28)16-7-9-20(21(13-16)31-2)33-12-4-6-23(30)27-26-22(29)5-3-11-32-19-10-8-17(24)14-18(19)25/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | ICFKWTVDQWOCQR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|