C20H22Cl2N2O5 — CID 4943400
4-(2,4-dichlorophenoxy)-N'-[2-(2-methoxyphenoxy)propanoyl]butanehydrazide (PubChem CID 4943400) has the molecular formula C20H22Cl2N2O5 and a molecular weight of 441.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N'-[2-(2-methoxyphenoxy)propanoyl]butanehydrazide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N'-[2-(2-methoxyphenoxy)propanoyl]butanehydrazide |
|---|---|
| PubChem CID | 4943400 |
| Molecular Formula | C20H22Cl2N2O5 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N'-[2-(2-methoxyphenoxy)propanoyl]butanehydrazide |
| SMILES | COc1ccccc1OC(C)C(=O)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O5/c1-13(29-18-7-4-3-6-17(18)27-2)20(26)24-23-19(25)8-5-11-28-16-10-9-14(21)12-15(16)22/h3-4,6-7,9-10,12-13H,5,8,11H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ZFYQFGUOFSOXDN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|