C12H14Cl2N2O4 — CID 7046351
(2S)-2-(2,4-dichlorophenoxy)-N'-(2-methoxyacetyl)propanehydrazide (PubChem CID 7046351) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N'-(2-methoxyacetyl)propanehydrazide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N'-(2-methoxyacetyl)propanehydrazide |
|---|---|
| PubChem CID | 7046351 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N'-(2-methoxyacetyl)propanehydrazide |
| SMILES | COCC(=O)NNC(=O)[C@H](C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-7(12(18)16-15-11(17)6-19-2)20-10-4-3-8(13)5-9(10)14/h3-5,7H,6H2,1-2H3,(H,15,17)(H,16,18)/t7-/m0/s1 |
| InChIKey | VXHIVPIOPOUZON-ZETCQYMHSA-N |
| XLogP | 1.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|