C17H14Cl4N2O4 — CID 3120230
2-(2,4-dichlorophenoxy)-N'-[2-(2,4-dichlorophenoxy)acetyl]propanehydrazide (PubChem CID 3120230) has the molecular formula C17H14Cl4N2O4 and a molecular weight of 452.12 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N'-[2-(2,4-dichlorophenoxy)acetyl]propanehydrazide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N'-[2-(2,4-dichlorophenoxy)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 3120230 |
| Molecular Formula | C17H14Cl4N2O4 |
| Molecular Weight | 452.12 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N'-[2-(2,4-dichlorophenoxy)acetyl]propanehydrazide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl4N2O4/c1-9(27-15-5-3-11(19)7-13(15)21)17(25)23-22-16(24)8-26-14-4-2-10(18)6-12(14)20/h2-7,9H,8H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | YBLJZLIREOYWTR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|