C14H18Cl2N2O3 — CID 41387582
N'-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]-3-methylbutanehydrazide (PubChem CID 41387582) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is N'-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]-3-methylbutanehydrazide.
| Compound Name | N'-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 41387582 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N'-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]-3-methylbutanehydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)[C@@H](C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-8(2)6-13(19)17-18-14(20)9(3)21-12-5-4-10(15)7-11(12)16/h4-5,7-9H,6H2,1-3H3,(H,17,19)(H,18,20)/t9-/m1/s1 |
| InChIKey | HZRRRMSUFRWYAD-SECBINFHSA-N |
| XLogP | 2.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|