C17H15Cl2N3O5 — CID 3120247
2-(2,4-dichlorophenoxy)-N'-[2-(4-nitrophenyl)acetyl]propanehydrazide (PubChem CID 3120247) has the molecular formula C17H15Cl2N3O5 and a molecular weight of 412.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N'-[2-(4-nitrophenyl)acetyl]propanehydrazide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N'-[2-(4-nitrophenyl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 3120247 |
| Molecular Formula | C17H15Cl2N3O5 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N'-[2-(4-nitrophenyl)acetyl]propanehydrazide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15Cl2N3O5/c1-10(27-15-7-4-12(18)9-14(15)19)17(24)21-20-16(23)8-11-2-5-13(6-3-11)22(25)26/h2-7,9-10H,8H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | JUFDPUROCDIAOI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|