C15H11Cl2N3O6 — CID 5226893
2-(2,4-dichlorophenoxy)-N-(2,4-dinitrophenyl)propanamide (PubChem CID 5226893) has the molecular formula C15H11Cl2N3O6 and a molecular weight of 400.17 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2,4-dinitrophenyl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2,4-dinitrophenyl)propanamide |
|---|---|
| PubChem CID | 5226893 |
| Molecular Formula | C15H11Cl2N3O6 |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2,4-dinitrophenyl)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11Cl2N3O6/c1-8(26-14-5-2-9(16)6-11(14)17)15(21)18-12-4-3-10(19(22)23)7-13(12)20(24)25/h2-8H,1H3,(H,18,21) |
| InChIKey | XDGANOHWDJJMJW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|