C16H12BrCl2N3O4S — CID 42561218
(2S)-N-[(2-bromo-4-nitrophenyl)carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 42561218) has the molecular formula C16H12BrCl2N3O4S and a molecular weight of 493.17 g/mol. Its IUPAC name is (2S)-N-[(2-bromo-4-nitrophenyl)carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | (2S)-N-[(2-bromo-4-nitrophenyl)carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 42561218 |
| Molecular Formula | C16H12BrCl2N3O4S |
| Molecular Weight | 493.17 g/mol |
| Exact Mass | 490.91 |
| IUPAC Name | (2S)-N-[(2-bromo-4-nitrophenyl)carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C16H12BrCl2N3O4S/c1-8(26-14-5-2-9(18)6-12(14)19)15(23)21-16(27)20-13-4-3-10(22(24)25)7-11(13)17/h2-8H,1H3,(H2,20,21,23,27)/t8-/m0/s1 |
| InChIKey | LULPGXARXIPYLL-QMMMGPOBSA-N |
| XLogP | 4.94 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.17 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|