C18H18Cl2N2O4S — CID 3988622
2-(2,4-dichlorophenoxy)-N-[(2,4-dimethoxyphenyl)carbamothioyl]propanamide (PubChem CID 3988622) has the molecular formula C18H18Cl2N2O4S and a molecular weight of 429.33 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(2,4-dimethoxyphenyl)carbamothioyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(2,4-dimethoxyphenyl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 3988622 |
| Molecular Formula | C18H18Cl2N2O4S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(2,4-dimethoxyphenyl)carbamothioyl]propanamide |
| SMILES | COc1ccc(NC(=S)NC(=O)C(C)Oc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H18Cl2N2O4S/c1-10(26-15-7-4-11(19)8-13(15)20)17(23)22-18(27)21-14-6-5-12(24-2)9-16(14)25-3/h4-10H,1-3H3,(H2,21,22,23,27) |
| InChIKey | FSTGBIGVVWCTOF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|