C18H18Cl2N2O2S — CID 5181953
2-(2,4-dichlorophenoxy)-N-[(3,4-dimethylphenyl)carbamothioyl]propanamide (PubChem CID 5181953) has the molecular formula C18H18Cl2N2O2S and a molecular weight of 397.33 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(3,4-dimethylphenyl)carbamothioyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(3,4-dimethylphenyl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 5181953 |
| Molecular Formula | C18H18Cl2N2O2S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(3,4-dimethylphenyl)carbamothioyl]propanamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)C(C)Oc2ccc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C18H18Cl2N2O2S/c1-10-4-6-14(8-11(10)2)21-18(25)22-17(23)12(3)24-16-7-5-13(19)9-15(16)20/h4-9,12H,1-3H3,(H2,21,22,23,25) |
| InChIKey | PQYCUEVNTWGUKF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|