C21H17Cl2N3O4S — CID 4274390
N-[3-[2-(2,4-dichlorophenoxy)propanoylcarbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 4274390) has the molecular formula C21H17Cl2N3O4S and a molecular weight of 478.36 g/mol. Its IUPAC name is N-[3-[2-(2,4-dichlorophenoxy)propanoylcarbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-(2,4-dichlorophenoxy)propanoylcarbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4274390 |
| Molecular Formula | C21H17Cl2N3O4S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | N-[3-[2-(2,4-dichlorophenoxy)propanoylcarbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C21H17Cl2N3O4S/c1-12(30-17-8-7-13(22)10-16(17)23)19(27)26-21(31)25-15-5-2-4-14(11-15)24-20(28)18-6-3-9-29-18/h2-12H,1H3,(H,24,28)(H2,25,26,27,31) |
| InChIKey | HSEOHCFPBHUTCY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|