C19H13Cl2N3O3S — CID 3495265
N-[3-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 3495265) has the molecular formula C19H13Cl2N3O3S and a molecular weight of 434.30 g/mol. Its IUPAC name is N-[3-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3495265 |
| Molecular Formula | C19H13Cl2N3O3S |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | N-[3-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=S)NC(=O)c2ccc(Cl)cc2Cl)c1)c1ccco1 |
| InChI | InChI=1S/C19H13Cl2N3O3S/c20-11-6-7-14(15(21)9-11)17(25)24-19(28)23-13-4-1-3-12(10-13)22-18(26)16-5-2-8-27-16/h1-10H,(H,22,26)(H2,23,24,25,28) |
| InChIKey | ZFQXIRPOGLTWFO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|