C20H12Cl2N4O3S2 — CID 17127453
N-[6-[(2,4-dichlorobenzoyl)carbamothioylamino]-1,3-benzothiazol-2-yl]furan-2-carboxamide (PubChem CID 17127453) has the molecular formula C20H12Cl2N4O3S2 and a molecular weight of 491.38 g/mol. Its IUPAC name is N-[6-[(2,4-dichlorobenzoyl)carbamothioylamino]-1,3-benzothiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[6-[(2,4-dichlorobenzoyl)carbamothioylamino]-1,3-benzothiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17127453 |
| Molecular Formula | C20H12Cl2N4O3S2 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | N-[6-[(2,4-dichlorobenzoyl)carbamothioylamino]-1,3-benzothiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1nc2ccc(NC(=S)NC(=O)c3ccc(Cl)cc3Cl)cc2s1)c1ccco1 |
| InChI | InChI=1S/C20H12Cl2N4O3S2/c21-10-3-5-12(13(22)8-10)17(27)25-19(30)23-11-4-6-14-16(9-11)31-20(24-14)26-18(28)15-2-1-7-29-15/h1-9H,(H,24,26,28)(H2,23,25,27,30) |
| InChIKey | WZNWICHEZGLTHG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|