C14H11N3O3S2 — CID 875146
N-[(6-methoxy-1,3-benzothiazol-2-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 875146) has the molecular formula C14H11N3O3S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-[(6-methoxy-1,3-benzothiazol-2-yl)carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[(6-methoxy-1,3-benzothiazol-2-yl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 875146 |
| Molecular Formula | C14H11N3O3S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N-[(6-methoxy-1,3-benzothiazol-2-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | COc1ccc2nc(NC(=S)NC(=O)c3ccco3)sc2c1 |
| InChI | InChI=1S/C14H11N3O3S2/c1-19-8-4-5-9-11(7-8)22-14(15-9)17-13(21)16-12(18)10-3-2-6-20-10/h2-7H,1H3,(H2,15,16,17,18,21) |
| InChIKey | WGGVSKKNPVAZHO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|