C13H14N4O3S2 — CID 843725
2-(furan-2-carbonylcarbamothioylamino)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 843725) has the molecular formula C13H14N4O3S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(furan-2-carbonylcarbamothioylamino)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(furan-2-carbonylcarbamothioylamino)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 843725 |
| Molecular Formula | C13H14N4O3S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-(furan-2-carbonylcarbamothioylamino)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=S)NC(=O)c2ccco2)sc1C(=O)N(C)C |
| InChI | InChI=1S/C13H14N4O3S2/c1-7-9(11(19)17(2)3)22-13(14-7)16-12(21)15-10(18)8-5-4-6-20-8/h4-6H,1-3H3,(H2,14,15,16,18,21) |
| InChIKey | FMFVWJWZRXZWQT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|