C15H16N4O2S2 — CID 843956
2-(benzoylcarbamothioylamino)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 843956) has the molecular formula C15H16N4O2S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-(benzoylcarbamothioylamino)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(benzoylcarbamothioylamino)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 843956 |
| Molecular Formula | C15H16N4O2S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-(benzoylcarbamothioylamino)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=S)NC(=O)c2ccccc2)sc1C(=O)N(C)C |
| InChI | InChI=1S/C15H16N4O2S2/c1-9-11(13(21)19(2)3)23-15(16-9)18-14(22)17-12(20)10-7-5-4-6-8-10/h4-8H,1-3H3,(H2,16,17,18,20,22) |
| InChIKey | FEQZWDMRVRMZPD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|