C13H12Cl2N4O2S — CID 142147683
2-[(2,6-dichloropyridine-4-carbonyl)amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 142147683) has the molecular formula C13H12Cl2N4O2S and a molecular weight of 359.24 g/mol. Its IUPAC name is 2-[(2,6-dichloropyridine-4-carbonyl)amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(2,6-dichloropyridine-4-carbonyl)amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 142147683 |
| Molecular Formula | C13H12Cl2N4O2S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 2-[(2,6-dichloropyridine-4-carbonyl)amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)c2cc(Cl)nc(Cl)c2)sc1C(=O)N(C)C |
| InChI | InChI=1S/C13H12Cl2N4O2S/c1-6-10(12(21)19(2)3)22-13(16-6)18-11(20)7-4-8(14)17-9(15)5-7/h4-5H,1-3H3,(H,16,18,20) |
| InChIKey | PPWOJSDSXSEMDZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|