C14H13ClN4O4S — CID 3257929
2-[(5-chloro-2-nitrobenzoyl)amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 3257929) has the molecular formula C14H13ClN4O4S and a molecular weight of 368.80 g/mol. Its IUPAC name is 2-[(5-chloro-2-nitrobenzoyl)amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(5-chloro-2-nitrobenzoyl)amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 3257929 |
| Molecular Formula | C14H13ClN4O4S |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-[(5-chloro-2-nitrobenzoyl)amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)c2cc(Cl)ccc2[N+](=O)[O-])sc1C(=O)N(C)C |
| InChI | InChI=1S/C14H13ClN4O4S/c1-7-11(13(21)18(2)3)24-14(16-7)17-12(20)9-6-8(15)4-5-10(9)19(22)23/h4-6H,1-3H3,(H,16,17,20) |
| InChIKey | PUCFROPUCNDEPL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|