C16H13Cl2N3O7 — CID 160700642
5-chloro-N,N-dimethyl-2-nitrobenzamide;5-chloro-2-nitrobenzoic acid (PubChem CID 160700642) has the molecular formula C16H13Cl2N3O7 and a molecular weight of 430.20 g/mol. Its IUPAC name is 5-chloro-N,N-dimethyl-2-nitrobenzamide;5-chloro-2-nitrobenzoic acid.
| Compound Name | 5-chloro-N,N-dimethyl-2-nitrobenzamide;5-chloro-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 160700642 |
| Molecular Formula | C16H13Cl2N3O7 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 5-chloro-N,N-dimethyl-2-nitrobenzamide;5-chloro-2-nitrobenzoic acid |
| SMILES | CN(C)C(=O)c1cc(Cl)ccc1[N+](=O)[O-].O=C(O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9ClN2O3.C7H4ClNO4/c1-11(2)9(13)7-5-6(10)3-4-8(7)12(14)15;8-4-1-2-6(9(12)13)5(3-4)7(10)11/h3-5H,1-2H3;1-3H,(H,10,11) |
| InChIKey | RQOMXKGLVIHDJQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|