C11H11ClN4O5 — CID 62923763
N,N-bis(2-amino-2-oxoethyl)-5-chloro-2-nitrobenzamide (PubChem CID 62923763) has the molecular formula C11H11ClN4O5 and a molecular weight of 314.69 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-5-chloro-2-nitrobenzamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-5-chloro-2-nitrobenzamide |
|---|---|
| PubChem CID | 62923763 |
| Molecular Formula | C11H11ClN4O5 |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-5-chloro-2-nitrobenzamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11ClN4O5/c12-6-1-2-8(16(20)21)7(3-6)11(19)15(4-9(13)17)5-10(14)18/h1-3H,4-5H2,(H2,13,17)(H2,14,18) |
| InChIKey | RDSBMQZJWCPFAO-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|