C11H10ClN3O6 — CID 43216991
4-amino-2-[(5-chloro-2-nitrobenzoyl)amino]-4-oxobutanoic acid (PubChem CID 43216991) has the molecular formula C11H10ClN3O6 and a molecular weight of 315.67 g/mol. Its IUPAC name is 4-amino-2-[(5-chloro-2-nitrobenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(5-chloro-2-nitrobenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43216991 |
| Molecular Formula | C11H10ClN3O6 |
| Molecular Weight | 315.67 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-amino-2-[(5-chloro-2-nitrobenzoyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)c1cc(Cl)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H10ClN3O6/c12-5-1-2-8(15(20)21)6(3-5)10(17)14-7(11(18)19)4-9(13)16/h1-3,7H,4H2,(H2,13,16)(H,14,17)(H,18,19) |
| InChIKey | NELSPISTPOZLQB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.67 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|