C11H11ClN2O4 — CID 2302928
(2R)-4-amino-2-[(2-chlorobenzoyl)amino]-4-oxobutanoic acid (PubChem CID 2302928) has the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. Its IUPAC name is (2R)-4-amino-2-[(2-chlorobenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(2-chlorobenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 2302928 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (2R)-4-amino-2-[(2-chlorobenzoyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)c1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H11ClN2O4/c12-7-4-2-1-3-6(7)10(16)14-8(11(17)18)5-9(13)15/h1-4,8H,5H2,(H2,13,15)(H,14,16)(H,17,18)/t8-/m1/s1 |
| InChIKey | ZHHYFQDAWUJSPO-MRVPVSSYSA-N |
| XLogP | 0.40 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |