C13H15ClN2O4S — CID 43240166
4-amino-2-[3-(2-chlorophenyl)sulfanylpropanoylamino]-4-oxobutanoic acid (PubChem CID 43240166) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is 4-amino-2-[3-(2-chlorophenyl)sulfanylpropanoylamino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[3-(2-chlorophenyl)sulfanylpropanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43240166 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-amino-2-[3-(2-chlorophenyl)sulfanylpropanoylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)CCSc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H15ClN2O4S/c14-8-3-1-2-4-10(8)21-6-5-12(18)16-9(13(19)20)7-11(15)17/h1-4,9H,5-7H2,(H2,15,17)(H,16,18)(H,19,20) |
| InChIKey | FXICZELZGATYKN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |