C13H14ClNO5S — CID 112733017
(2S)-2-[3-(2-chlorophenyl)sulfanylpropanoylamino]butanedioic acid (PubChem CID 112733017) has the molecular formula C13H14ClNO5S and a molecular weight of 331.78 g/mol. Its IUPAC name is (2S)-2-[3-(2-chlorophenyl)sulfanylpropanoylamino]butanedioic acid.
| Compound Name | (2S)-2-[3-(2-chlorophenyl)sulfanylpropanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 112733017 |
| Molecular Formula | C13H14ClNO5S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | (2S)-2-[3-(2-chlorophenyl)sulfanylpropanoylamino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)CCSc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H14ClNO5S/c14-8-3-1-2-4-10(8)21-6-5-11(16)15-9(13(19)20)7-12(17)18/h1-4,9H,5-7H2,(H,15,16)(H,17,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | SXSJSOVZHKAELF-VIFPVBQESA-N |
| XLogP | 1.87 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |