C14H18N2O4S — CID 107821033
(2R)-4-amino-4-oxo-2-(4-phenylsulfanylbutanoylamino)butanoic acid (PubChem CID 107821033) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is (2R)-4-amino-4-oxo-2-(4-phenylsulfanylbutanoylamino)butanoic acid.
| Compound Name | (2R)-4-amino-4-oxo-2-(4-phenylsulfanylbutanoylamino)butanoic acid |
|---|---|
| PubChem CID | 107821033 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (2R)-4-amino-4-oxo-2-(4-phenylsulfanylbutanoylamino)butanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)CCCSc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H18N2O4S/c15-12(17)9-11(14(19)20)16-13(18)7-4-8-21-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,15,17)(H,16,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | RSZRRAQNLIMLIF-LLVKDONJSA-N |
| XLogP | 1.00 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|