C11H13N3O4 — CID 16772019
4-amino-4-oxo-2-(phenylcarbamoylamino)butanoic acid (PubChem CID 16772019) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 4-amino-4-oxo-2-(phenylcarbamoylamino)butanoic acid.
| Compound Name | 4-amino-4-oxo-2-(phenylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 16772019 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4-amino-4-oxo-2-(phenylcarbamoylamino)butanoic acid |
| SMILES | NC(=O)CC(NC(=O)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13N3O4/c12-9(15)6-8(10(16)17)14-11(18)13-7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,12,15)(H,16,17)(H2,13,14,18) |
| InChIKey | HRXGJODWZCGABS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |