C13H17N3O4 — CID 107825937
(2R)-4-amino-2-[(2,6-dimethylphenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 107825937) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is (2R)-4-amino-2-[(2,6-dimethylphenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(2,6-dimethylphenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107825937 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (2R)-4-amino-2-[(2,6-dimethylphenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | Cc1cccc(C)c1NC(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H17N3O4/c1-7-4-3-5-8(2)11(7)16-13(20)15-9(12(18)19)6-10(14)17/h3-5,9H,6H2,1-2H3,(H2,14,17)(H,18,19)(H2,15,16,20)/t9-/m1/s1 |
| InChIKey | SBWWETAMKHNRJQ-SECBINFHSA-N |
| XLogP | 0.75 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |