C11H13ClN2O4 — CID 80757028
(2R)-2-[(2-chloro-6-methylphenyl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 80757028) has the molecular formula C11H13ClN2O4 and a molecular weight of 272.69 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-6-methylphenyl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(2-chloro-6-methylphenyl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80757028 |
| Molecular Formula | C11H13ClN2O4 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (2R)-2-[(2-chloro-6-methylphenyl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | Cc1cccc(Cl)c1NC(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C11H13ClN2O4/c1-6-3-2-4-7(12)9(6)14-11(18)13-8(5-15)10(16)17/h2-4,8,15H,5H2,1H3,(H,16,17)(H2,13,14,18)/t8-/m1/s1 |
| InChIKey | DRBXOVAQLYSCLY-MRVPVSSYSA-N |
| XLogP | 1.22 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |