C12H13Cl2N3O4 — CID 65498843
5-amino-2-[(2,6-dichlorophenyl)carbamoylamino]-5-oxopentanoic acid (PubChem CID 65498843) has the molecular formula C12H13Cl2N3O4 and a molecular weight of 334.16 g/mol. Its IUPAC name is 5-amino-2-[(2,6-dichlorophenyl)carbamoylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(2,6-dichlorophenyl)carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 65498843 |
| Molecular Formula | C12H13Cl2N3O4 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 5-amino-2-[(2,6-dichlorophenyl)carbamoylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)Nc1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13Cl2N3O4/c13-6-2-1-3-7(14)10(6)17-12(21)16-8(11(19)20)4-5-9(15)18/h1-3,8H,4-5H2,(H2,15,18)(H,19,20)(H2,16,17,21) |
| InChIKey | DRTDYGMCUDRCLS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |