C11H11BrCl2N2O4 — CID 107825780
(2S)-2-[(4-bromo-2,6-dichlorophenyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107825780) has the molecular formula C11H11BrCl2N2O4 and a molecular weight of 386.03 g/mol. Its IUPAC name is (2S)-2-[(4-bromo-2,6-dichlorophenyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(4-bromo-2,6-dichlorophenyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107825780 |
| Molecular Formula | C11H11BrCl2N2O4 |
| Molecular Weight | 386.03 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | (2S)-2-[(4-bromo-2,6-dichlorophenyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(Nc1c(Cl)cc(Br)cc1Cl)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C11H11BrCl2N2O4/c12-5-3-6(13)9(7(14)4-5)16-11(20)15-8(1-2-17)10(18)19/h3-4,8,17H,1-2H2,(H,18,19)(H2,15,16,20)/t8-/m0/s1 |
| InChIKey | YXBURZVKOIAKBC-QMMMGPOBSA-N |
| XLogP | 2.71 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.03 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |