C11H11Cl2FN2O4 — CID 107829586
(2S)-2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107829586) has the molecular formula C11H11Cl2FN2O4 and a molecular weight of 325.12 g/mol. Its IUPAC name is (2S)-2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107829586 |
| Molecular Formula | C11H11Cl2FN2O4 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (2S)-2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(Nc1cc(Cl)c(F)c(Cl)c1)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C11H11Cl2FN2O4/c12-6-3-5(4-7(13)9(6)14)15-11(20)16-8(1-2-17)10(18)19/h3-4,8,17H,1-2H2,(H,18,19)(H2,15,16,20)/t8-/m0/s1 |
| InChIKey | DRXIPSSOISFSRY-QMMMGPOBSA-N |
| XLogP | 2.09 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|