(2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid

C12H13F3N2O3 — CID 107566862

IUPAC(2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid
SMILESCCC[C@H](NC(=O)Nc1cc(F)c(F)c(F)c1)C(=O)O
InChIInChI=1S/C12H13F3N2O3/c1-2-3-9(11(18)19)17-12(20)16-6-4-7(13)10(15)8(14)5-6/h4-5,9H,2-3H2,1H3,(H,18,19)(H2,16,17,20)/t9-/m0/s1
InChIKeyDPZVUJCAYAMBJO-VIFPVBQESA-N
MW290.24 g/mol
LogP2.48
Rot. Bonds5

About (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid

(2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid (PubChem CID 107566862) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid.

Molecular Properties

Compound Name(2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid
PubChem CID107566862
Molecular FormulaC12H13F3N2O3
Molecular Weight290.24 g/mol
Exact Mass290.09
IUPAC Name(2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid
SMILESCCC[C@H](NC(=O)Nc1cc(F)c(F)c(F)c1)C(=O)O
InChIInChI=1S/C12H13F3N2O3/c1-2-3-9(11(18)19)17-12(20)16-6-4-7(13)10(15)8(14)5-6/h4-5,9H,2-3H2,1H3,(H,18,19)(H2,16,17,20)/t9-/m0/s1
InChIKeyDPZVUJCAYAMBJO-VIFPVBQESA-N
XLogP2.48
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.24
LogP ≤ 52.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid?
The IUPAC name of (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid (CID 107566862) is (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid.
What is the SMILES notation for (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid?
The canonical SMILES for (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid is CCC[C@H](NC(=O)Nc1cc(F)c(F)c(F)c1)C(=O)O.
What is the InChIKey of (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid?
The InChIKey is DPZVUJCAYAMBJO-VIFPVBQESA-N. The full InChI is InChI=1S/C12H13F3N2O3/c1-2-3-9(11(18)19)17-12(20)16-6-4-7(13)10(15)8(14)5-6/h4-5,9H,2-3H2,1H3,(H,18,19)(H2,16,17,20)/t9-/m0/s1.
What are the key properties of (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid?
(2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid has a molecular weight of 290.24 g/mol, XLogP of 2.48, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3,4,5-trifluorophenyl)carbamoylamino]pentanoic acid is sourced from PubChem (CID 107566862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).