C12H13BrF2N2O3 — CID 61196156
2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]pentanoic acid (PubChem CID 61196156) has the molecular formula C12H13BrF2N2O3 and a molecular weight of 351.15 g/mol. Its IUPAC name is 2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]pentanoic acid.
| Compound Name | 2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 61196156 |
| Molecular Formula | C12H13BrF2N2O3 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)Nc1c(F)cc(F)cc1Br)C(=O)O |
| InChI | InChI=1S/C12H13BrF2N2O3/c1-2-3-9(11(18)19)16-12(20)17-10-7(13)4-6(14)5-8(10)15/h4-5,9H,2-3H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | XNTZXXSOUDBYPV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |