About 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid
4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 61195411) has the molecular formula C11H10BrF2N3O4
and a molecular weight of 366.12 g/mol. Its IUPAC name is 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid |
| PubChem CID | 61195411 |
| Molecular Formula | C11H10BrF2N3O4 |
| Molecular Weight | 366.12 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)Nc1c(F)cc(F)cc1Br)C(=O)O |
| InChI | InChI=1S/C11H10BrF2N3O4/c12-5-1-4(13)2-6(14)9(5)17-11(21)16-7(10(19)20)3-8(15)18/h1-2,7H,3H2,(H2,15,18)(H,19,20)(H2,16,17,21) |
| InChIKey | MEMNPZDZCWFQHK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid?
The IUPAC name of 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid (CID 61195411) is 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid.
What is the SMILES notation for 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid?
The canonical SMILES for 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid is NC(=O)CC(NC(=O)Nc1c(F)cc(F)cc1Br)C(=O)O.
What is the InChIKey of 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid?
The InChIKey is MEMNPZDZCWFQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrF2N3O4/c12-5-1-4(13)2-6(14)9(5)17-11(21)16-7(10(19)20)3-8(15)18/h1-2,7H,3H2,(H2,15,18)(H,19,20)(H2,16,17,21).
What are the key properties of 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid?
4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid has a molecular weight of 366.12 g/mol, XLogP of 1.18, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]-4-oxobutanoic acid is sourced from PubChem (CID 61195411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).