C11H9BrF2N2O5 — CID 102854450
(2R)-2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]butanedioic acid (PubChem CID 102854450) has the molecular formula C11H9BrF2N2O5 and a molecular weight of 367.10 g/mol. Its IUPAC name is (2R)-2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]butanedioic acid.
| Compound Name | (2R)-2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 102854450 |
| Molecular Formula | C11H9BrF2N2O5 |
| Molecular Weight | 367.10 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | (2R)-2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)Nc1cc(Br)c(F)cc1F)C(=O)O |
| InChI | InChI=1S/C11H9BrF2N2O5/c12-4-1-7(6(14)2-5(4)13)15-11(21)16-8(10(19)20)3-9(17)18/h1-2,8H,3H2,(H,17,18)(H,19,20)(H2,15,16,21)/t8-/m1/s1 |
| InChIKey | KIZFAXXVMIYWEU-MRVPVSSYSA-N |
| XLogP | 1.78 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.10 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|