3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid

C10H9BrF2N2O3 — CID 102854362

IUPAC3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid
SMILESO=C(O)CCNC(=O)Nc1cc(Br)c(F)cc1F
InChIInChI=1S/C10H9BrF2N2O3/c11-5-3-8(7(13)4-6(5)12)15-10(18)14-2-1-9(16)17/h3-4H,1-2H2,(H,16,17)(H2,14,15,18)
InChIKeyDIQKCGILLAQFAE-UHFFFAOYSA-N
MW323.09 g/mol
LogP2.32
Rot. Bonds4

About 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid

3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid (PubChem CID 102854362) has the molecular formula C10H9BrF2N2O3 and a molecular weight of 323.09 g/mol. Its IUPAC name is 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid.

Molecular Properties

Compound Name3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid
PubChem CID102854362
Molecular FormulaC10H9BrF2N2O3
Molecular Weight323.09 g/mol
Exact Mass321.98
IUPAC Name3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid
SMILESO=C(O)CCNC(=O)Nc1cc(Br)c(F)cc1F
InChIInChI=1S/C10H9BrF2N2O3/c11-5-3-8(7(13)4-6(5)12)15-10(18)14-2-1-9(16)17/h3-4H,1-2H2,(H,16,17)(H2,14,15,18)
InChIKeyDIQKCGILLAQFAE-UHFFFAOYSA-N
XLogP2.32
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.09
LogP ≤ 52.32
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid?
The IUPAC name of 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid (CID 102854362) is 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid.
What is the SMILES notation for 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid?
The canonical SMILES for 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid is O=C(O)CCNC(=O)Nc1cc(Br)c(F)cc1F.
What is the InChIKey of 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid?
The InChIKey is DIQKCGILLAQFAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2N2O3/c11-5-3-8(7(13)4-6(5)12)15-10(18)14-2-1-9(16)17/h3-4H,1-2H2,(H,16,17)(H2,14,15,18).
What are the key properties of 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid?
3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid has a molecular weight of 323.09 g/mol, XLogP of 2.32, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromo-2,4-difluorophenyl)carbamoylamino]propanoic acid is sourced from PubChem (CID 102854362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).