3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid

C10H10Br2N2O3 — CID 54954210

IUPAC3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid
SMILESO=C(O)CCNC(=O)Nc1ccc(Br)cc1Br
InChIInChI=1S/C10H10Br2N2O3/c11-6-1-2-8(7(12)5-6)14-10(17)13-4-3-9(15)16/h1-2,5H,3-4H2,(H,15,16)(H2,13,14,17)
InChIKeyUSQRAGPIAYKFIU-UHFFFAOYSA-N
MW366.01 g/mol
LogP2.81
Rot. Bonds4

About 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid

3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid (PubChem CID 54954210) has the molecular formula C10H10Br2N2O3 and a molecular weight of 366.01 g/mol. Its IUPAC name is 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid.

Molecular Properties

Compound Name3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid
PubChem CID54954210
Molecular FormulaC10H10Br2N2O3
Molecular Weight366.01 g/mol
Exact Mass363.91
IUPAC Name3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid
SMILESO=C(O)CCNC(=O)Nc1ccc(Br)cc1Br
InChIInChI=1S/C10H10Br2N2O3/c11-6-1-2-8(7(12)5-6)14-10(17)13-4-3-9(15)16/h1-2,5H,3-4H2,(H,15,16)(H2,13,14,17)
InChIKeyUSQRAGPIAYKFIU-UHFFFAOYSA-N
XLogP2.81
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.01
LogP ≤ 52.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid?
The IUPAC name of 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid (CID 54954210) is 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid.
What is the SMILES notation for 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid?
The canonical SMILES for 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid is O=C(O)CCNC(=O)Nc1ccc(Br)cc1Br.
What is the InChIKey of 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid?
The InChIKey is USQRAGPIAYKFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Br2N2O3/c11-6-1-2-8(7(12)5-6)14-10(17)13-4-3-9(15)16/h1-2,5H,3-4H2,(H,15,16)(H2,13,14,17).
What are the key properties of 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid?
3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid has a molecular weight of 366.01 g/mol, XLogP of 2.81, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dibromophenyl)carbamoylamino]propanoic acid is sourced from PubChem (CID 54954210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).