C14H19BrN2O5 — CID 122089119
3-[[5-bromo-2-(2-ethoxyethoxy)phenyl]carbamoylamino]propanoic acid (PubChem CID 122089119) has the molecular formula C14H19BrN2O5 and a molecular weight of 375.22 g/mol. Its IUPAC name is 3-[[5-bromo-2-(2-ethoxyethoxy)phenyl]carbamoylamino]propanoic acid.
| Compound Name | 3-[[5-bromo-2-(2-ethoxyethoxy)phenyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122089119 |
| Molecular Formula | C14H19BrN2O5 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 3-[[5-bromo-2-(2-ethoxyethoxy)phenyl]carbamoylamino]propanoic acid |
| SMILES | CCOCCOc1ccc(Br)cc1NC(=O)NCCC(=O)O |
| InChI | InChI=1S/C14H19BrN2O5/c1-2-21-7-8-22-12-4-3-10(15)9-11(12)17-14(20)16-6-5-13(18)19/h3-4,9H,2,5-8H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | VIMJSZDNLAPZDY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|