C18H25Br2NO7 — CID 53338797
4-[2-[2-[2-[2-(2,5-dibromophenoxy)ethoxy]ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid (PubChem CID 53338797) has the molecular formula C18H25Br2NO7 and a molecular weight of 527.21 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-(2,5-dibromophenoxy)ethoxy]ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-[2-(2,5-dibromophenoxy)ethoxy]ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 53338797 |
| Molecular Formula | C18H25Br2NO7 |
| Molecular Weight | 527.21 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | 4-[2-[2-[2-[2-(2,5-dibromophenoxy)ethoxy]ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCOCCOCCOCCOc1cc(Br)ccc1Br |
| InChI | InChI=1S/C18H25Br2NO7/c19-14-1-2-15(20)16(13-14)28-12-11-27-10-9-26-8-7-25-6-5-21-17(22)3-4-18(23)24/h1-2,13H,3-12H2,(H,21,22)(H,23,24) |
| InChIKey | OQHQWQCSKAZAEA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|