C14H20Br2O5 — CID 53338792
2-[2-[2-[2-(2,5-dibromophenoxy)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 53338792) has the molecular formula C14H20Br2O5 and a molecular weight of 428.12 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,5-dibromophenoxy)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-(2,5-dibromophenoxy)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 53338792 |
| Molecular Formula | C14H20Br2O5 |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | 2-[2-[2-[2-(2,5-dibromophenoxy)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOCCOc1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H20Br2O5/c15-12-1-2-13(16)14(11-12)21-10-9-20-8-7-19-6-5-18-4-3-17/h1-2,11,17H,3-10H2 |
| InChIKey | KYZLDRGPMBPPPI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|