C30H42O12 — CID 89126006
2-[2-[4,5,8-tris[2-(2-hydroxyethoxy)ethoxy]anthracen-1-yl]oxyethoxy]ethanol (PubChem CID 89126006) has the molecular formula C30H42O12 and a molecular weight of 594.65 g/mol. Its IUPAC name is 2-[2-[4,5,8-tris[2-(2-hydroxyethoxy)ethoxy]anthracen-1-yl]oxyethoxy]ethanol.
| Compound Name | 2-[2-[4,5,8-tris[2-(2-hydroxyethoxy)ethoxy]anthracen-1-yl]oxyethoxy]ethanol |
|---|---|
| PubChem CID | 89126006 |
| Molecular Formula | C30H42O12 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 2-[2-[4,5,8-tris[2-(2-hydroxyethoxy)ethoxy]anthracen-1-yl]oxyethoxy]ethanol |
| SMILES | OCCOCCOc1ccc(OCCOCCO)c2cc3c(OCCOCCO)ccc(OCCOCCO)c3cc12 |
| InChI | InChI=1S/C30H42O12/c31-5-9-35-13-17-39-27-1-2-28(40-18-14-36-10-6-32)24-22-26-25(21-23(24)27)29(41-19-15-37-11-7-33)3-4-30(26)42-20-16-38-12-8-34/h1-4,21-22,31-34H,5-20H2 |
| InChIKey | MVSKBSQJPYAJOU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|