C10H12F2O3 — CID 63268776
2-[2-(2,5-difluorophenoxy)ethoxy]ethanol (PubChem CID 63268776) has the molecular formula C10H12F2O3 and a molecular weight of 218.20 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(2,5-difluorophenoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 63268776 |
| Molecular Formula | C10H12F2O3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-[2-(2,5-difluorophenoxy)ethoxy]ethanol |
| SMILES | OCCOCCOc1cc(F)ccc1F |
| InChI | InChI=1S/C10H12F2O3/c11-8-1-2-9(12)10(7-8)15-6-5-14-4-3-13/h1-2,7,13H,3-6H2 |
| InChIKey | PELFNYHWGNJITJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|