C12H16F2O2 — CID 106802707
6-(2,5-difluorophenoxy)hexan-3-ol (PubChem CID 106802707) has the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. Its IUPAC name is 6-(2,5-difluorophenoxy)hexan-3-ol.
| Compound Name | 6-(2,5-difluorophenoxy)hexan-3-ol |
|---|---|
| PubChem CID | 106802707 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 6-(2,5-difluorophenoxy)hexan-3-ol |
| SMILES | CCC(O)CCCOc1cc(F)ccc1F |
| InChI | InChI=1S/C12H16F2O2/c1-2-10(15)4-3-7-16-12-8-9(13)5-6-11(12)14/h5-6,8,10,15H,2-4,7H2,1H3 |
| InChIKey | DUPYHGAOQMDGHJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|